C29H25N3O — CID 20577222
2-[2-[2-(3-aminophenyl)phenyl]-4,5-diphenylimidazol-1-yl]ethanol (PubChem CID 20577222) has the molecular formula C29H25N3O and a molecular weight of 431.54 g/mol. Its IUPAC name is 2-[2-[2-(3-aminophenyl)phenyl]-4,5-diphenylimidazol-1-yl]ethanol.
| Compound Name | 2-[2-[2-(3-aminophenyl)phenyl]-4,5-diphenylimidazol-1-yl]ethanol |
|---|---|
| PubChem CID | 20577222 |
| Molecular Formula | C29H25N3O |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 2-[2-[2-(3-aminophenyl)phenyl]-4,5-diphenylimidazol-1-yl]ethanol |
| SMILES | Nc1cccc(-c2ccccc2-c2nc(-c3ccccc3)c(-c3ccccc3)n2CCO)c1 |
| InChI | InChI=1S/C29H25N3O/c30-24-15-9-14-23(20-24)25-16-7-8-17-26(25)29-31-27(21-10-3-1-4-11-21)28(32(29)18-19-33)22-12-5-2-6-13-22/h1-17,20,33H,18-19,30H2 |
| InChIKey | SDQAZZZWHWOPHH-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|