C23H26N2O — CID 20586116
7-(2-methyl-4,5-diphenylimidazol-1-yl)heptan-2-one (PubChem CID 20586116) has the molecular formula C23H26N2O and a molecular weight of 346.47 g/mol. Its IUPAC name is 7-(2-methyl-4,5-diphenylimidazol-1-yl)heptan-2-one.
| Compound Name | 7-(2-methyl-4,5-diphenylimidazol-1-yl)heptan-2-one |
|---|---|
| PubChem CID | 20586116 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 7-(2-methyl-4,5-diphenylimidazol-1-yl)heptan-2-one |
| SMILES | CC(=O)CCCCCn1c(C)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C23H26N2O/c1-18(26)12-6-5-11-17-25-19(2)24-22(20-13-7-3-8-14-20)23(25)21-15-9-4-10-16-21/h3-4,7-10,13-16H,5-6,11-12,17H2,1-2H3 |
| InChIKey | PENLQZRNXJROQI-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|