C22H21N5O3 — CID 11647070
2-[(3-amino-4,5-diphenylpyrazolo[3,4-c]pyridazin-1-yl)methoxy]ethyl acetate (PubChem CID 11647070) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is 2-[(3-amino-4,5-diphenylpyrazolo[3,4-c]pyridazin-1-yl)methoxy]ethyl acetate.
| Compound Name | 2-[(3-amino-4,5-diphenylpyrazolo[3,4-c]pyridazin-1-yl)methoxy]ethyl acetate |
|---|---|
| PubChem CID | 11647070 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 2-[(3-amino-4,5-diphenylpyrazolo[3,4-c]pyridazin-1-yl)methoxy]ethyl acetate |
| SMILES | CC(=O)OCCOCn1nc(N)c2c(-c3ccccc3)c(-c3ccccc3)nnc21 |
| InChI | InChI=1S/C22H21N5O3/c1-15(28)30-13-12-29-14-27-22-19(21(23)26-27)18(16-8-4-2-5-9-16)20(24-25-22)17-10-6-3-7-11-17/h2-11H,12-14H2,1H3,(H2,23,26) |
| InChIKey | ZQRUHPWJCFVZSZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|