C16H17N5O3 — CID 102255903
2-[(6-anilinopurin-9-yl)methoxy]ethyl acetate (PubChem CID 102255903) has the molecular formula C16H17N5O3 and a molecular weight of 327.34 g/mol. Its IUPAC name is 2-[(6-anilinopurin-9-yl)methoxy]ethyl acetate.
| Compound Name | 2-[(6-anilinopurin-9-yl)methoxy]ethyl acetate |
|---|---|
| PubChem CID | 102255903 |
| Molecular Formula | C16H17N5O3 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2-[(6-anilinopurin-9-yl)methoxy]ethyl acetate |
| SMILES | CC(=O)OCCOCn1cnc2c(Nc3ccccc3)ncnc21 |
| InChI | InChI=1S/C16H17N5O3/c1-12(22)24-8-7-23-11-21-10-19-14-15(17-9-18-16(14)21)20-13-5-3-2-4-6-13/h2-6,9-10H,7-8,11H2,1H3,(H,17,18,20) |
| InChIKey | LOTGJSSNXCZGCE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|