C14H17N5O5 — CID 7308373
[(2S)-3-(6-acetamidopurin-9-yl)-2-acetyloxypropyl] acetate (PubChem CID 7308373) has the molecular formula C14H17N5O5 and a molecular weight of 335.32 g/mol. Its IUPAC name is [(2S)-3-(6-acetamidopurin-9-yl)-2-acetyloxypropyl] acetate.
| Compound Name | [(2S)-3-(6-acetamidopurin-9-yl)-2-acetyloxypropyl] acetate |
|---|---|
| PubChem CID | 7308373 |
| Molecular Formula | C14H17N5O5 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | [(2S)-3-(6-acetamidopurin-9-yl)-2-acetyloxypropyl] acetate |
| SMILES | CC(=O)Nc1ncnc2c1ncn2C[C@@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C14H17N5O5/c1-8(20)18-13-12-14(16-6-15-13)19(7-17-12)4-11(24-10(3)22)5-23-9(2)21/h6-7,11H,4-5H2,1-3H3,(H,15,16,18,20)/t11-/m0/s1 |
| InChIKey | XUFDNZXPBXZHHN-NSHDSACASA-N |
| XLogP | 0.28 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |