C14H18N4O5S — CID 67883597
[3-acetyloxy-2-[(6-methylsulfanylpurin-9-yl)methoxy]propyl] acetate (PubChem CID 67883597) has the molecular formula C14H18N4O5S and a molecular weight of 354.39 g/mol. Its IUPAC name is [3-acetyloxy-2-[(6-methylsulfanylpurin-9-yl)methoxy]propyl] acetate.
| Compound Name | [3-acetyloxy-2-[(6-methylsulfanylpurin-9-yl)methoxy]propyl] acetate |
|---|---|
| PubChem CID | 67883597 |
| Molecular Formula | C14H18N4O5S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | [3-acetyloxy-2-[(6-methylsulfanylpurin-9-yl)methoxy]propyl] acetate |
| SMILES | CSc1ncnc2c1ncn2COC(COC(C)=O)COC(C)=O |
| InChI | InChI=1S/C14H18N4O5S/c1-9(19)21-4-11(5-22-10(2)20)23-8-18-7-17-12-13(18)15-6-16-14(12)24-3/h6-7,11H,4-5,8H2,1-3H3 |
| InChIKey | QPWOPRMODAKWRJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 105.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |