C13H17N5O7 — CID 70449513
[2-[(6-aminopurin-9-yl)methoxy]-3-methoxycarbonyloxypropyl] methyl carbonate (PubChem CID 70449513) has the molecular formula C13H17N5O7 and a molecular weight of 355.31 g/mol. Its IUPAC name is [2-[(6-aminopurin-9-yl)methoxy]-3-methoxycarbonyloxypropyl] methyl carbonate.
| Compound Name | [2-[(6-aminopurin-9-yl)methoxy]-3-methoxycarbonyloxypropyl] methyl carbonate |
|---|---|
| PubChem CID | 70449513 |
| Molecular Formula | C13H17N5O7 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | [2-[(6-aminopurin-9-yl)methoxy]-3-methoxycarbonyloxypropyl] methyl carbonate |
| SMILES | COC(=O)OCC(COC(=O)OC)OCn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C13H17N5O7/c1-21-12(19)23-3-8(4-24-13(20)22-2)25-7-18-6-17-9-10(14)15-5-16-11(9)18/h5-6,8H,3-4,7H2,1-2H3,(H2,14,15,16) |
| InChIKey | IPLFXWNXBKNZOF-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 149.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |