C10H15N5O4P+ — CID 173311728
1-[(6-aminopurin-9-yl)methoxy]butan-2-yloxy-hydroxy-oxophosphanium (PubChem CID 173311728) has the molecular formula C10H15N5O4P+ and a molecular weight of 300.24 g/mol. Its IUPAC name is 1-[(6-aminopurin-9-yl)methoxy]butan-2-yloxy-hydroxy-oxophosphanium.
| Compound Name | 1-[(6-aminopurin-9-yl)methoxy]butan-2-yloxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 173311728 |
| Molecular Formula | C10H15N5O4P+ |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 1-[(6-aminopurin-9-yl)methoxy]butan-2-yloxy-hydroxy-oxophosphanium |
| SMILES | CCC(COCn1cnc2c(N)ncnc21)O[P+](=O)O |
| InChI | InChI=1S/C10H14N5O4P/c1-2-7(19-20(16)17)3-18-6-15-5-14-8-9(11)12-4-13-10(8)15/h4-5,7H,2-3,6H2,1H3,(H2-,11,12,13,16,17)/p+1 |
| InChIKey | GJVFVFYBNJFYCB-UHFFFAOYSA-O |
| XLogP | 0.83 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|