C11H15N5O4 — CID 5271673
2-methoxyethyl 3-(6-aminopurin-9-yl)-2-hydroxypropanoate (PubChem CID 5271673) has the molecular formula C11H15N5O4 and a molecular weight of 281.27 g/mol. Its IUPAC name is 2-methoxyethyl 3-(6-aminopurin-9-yl)-2-hydroxypropanoate.
| Compound Name | 2-methoxyethyl 3-(6-aminopurin-9-yl)-2-hydroxypropanoate |
|---|---|
| PubChem CID | 5271673 |
| Molecular Formula | C11H15N5O4 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 2-methoxyethyl 3-(6-aminopurin-9-yl)-2-hydroxypropanoate |
| SMILES | COCCOC(=O)C(O)Cn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C11H15N5O4/c1-19-2-3-20-11(18)7(17)4-16-6-15-8-9(12)13-5-14-10(8)16/h5-7,17H,2-4H2,1H3,(H2,12,13,14) |
| InChIKey | GZYQTOJIOFPWLI-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|