C12H15N5O4 — CID 131879127
prop-2-enyl (2R,3R)-4-(6-aminopurin-9-yl)-2,3-dihydroxybutanoate (PubChem CID 131879127) has the molecular formula C12H15N5O4 and a molecular weight of 293.28 g/mol. Its IUPAC name is prop-2-enyl (2R,3R)-4-(6-aminopurin-9-yl)-2,3-dihydroxybutanoate.
| Compound Name | prop-2-enyl (2R,3R)-4-(6-aminopurin-9-yl)-2,3-dihydroxybutanoate |
|---|---|
| PubChem CID | 131879127 |
| Molecular Formula | C12H15N5O4 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | prop-2-enyl (2R,3R)-4-(6-aminopurin-9-yl)-2,3-dihydroxybutanoate |
| SMILES | C=CCOC(=O)[C@H](O)[C@H](O)Cn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C12H15N5O4/c1-2-3-21-12(20)9(19)7(18)4-17-6-16-8-10(13)14-5-15-11(8)17/h2,5-7,9,18-19H,1,3-4H2,(H2,13,14,15)/t7-,9-/m1/s1 |
| InChIKey | LIJNZHKJOVLHNK-VXNVDRBHSA-N |
| XLogP | -1.14 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|