C12H19N7O2 — CID 143306855
1-[2-aminoethyl-[2-(6-aminopurin-9-yl)-1-hydroxyethyl]amino]propan-2-one (PubChem CID 143306855) has the molecular formula C12H19N7O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is 1-[2-aminoethyl-[2-(6-aminopurin-9-yl)-1-hydroxyethyl]amino]propan-2-one.
| Compound Name | 1-[2-aminoethyl-[2-(6-aminopurin-9-yl)-1-hydroxyethyl]amino]propan-2-one |
|---|---|
| PubChem CID | 143306855 |
| Molecular Formula | C12H19N7O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 1-[2-aminoethyl-[2-(6-aminopurin-9-yl)-1-hydroxyethyl]amino]propan-2-one |
| SMILES | CC(=O)CN(CCN)C(O)Cn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C12H19N7O2/c1-8(20)4-18(3-2-13)9(21)5-19-7-17-10-11(14)15-6-16-12(10)19/h6-7,9,21H,2-5,13H2,1H3,(H2,14,15,16) |
| InChIKey | BNWQMJVOQRSQMT-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 136.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|