C30H30N4O5S — CID 67883438
1-[(4-methoxyphenyl)-diphenylmethoxy]-2-[(6-methylsulfanylpurin-9-yl)methoxy]propane-1,3-diol (PubChem CID 67883438) has the molecular formula C30H30N4O5S and a molecular weight of 558.66 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)-diphenylmethoxy]-2-[(6-methylsulfanylpurin-9-yl)methoxy]propane-1,3-diol.
| Compound Name | 1-[(4-methoxyphenyl)-diphenylmethoxy]-2-[(6-methylsulfanylpurin-9-yl)methoxy]propane-1,3-diol |
|---|---|
| PubChem CID | 67883438 |
| Molecular Formula | C30H30N4O5S |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | 1-[(4-methoxyphenyl)-diphenylmethoxy]-2-[(6-methylsulfanylpurin-9-yl)methoxy]propane-1,3-diol |
| SMILES | COc1ccc(C(OC(O)C(CO)OCn2cnc3c(SC)ncnc32)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H30N4O5S/c1-37-24-15-13-23(14-16-24)30(21-9-5-3-6-10-21,22-11-7-4-8-12-22)39-29(36)25(17-35)38-20-34-19-33-26-27(34)31-18-32-28(26)40-2/h3-16,18-19,25,29,35-36H,17,20H2,1-2H3 |
| InChIKey | KTKJGIZXXLWQLE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 111.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|