C32H32N4O6 — CID 159810858
9-[(4R)-4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-hydroxy-2-oxopentyl]-1H-purin-6-one (PubChem CID 159810858) has the molecular formula C32H32N4O6 and a molecular weight of 568.63 g/mol. Its IUPAC name is 9-[(4R)-4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-hydroxy-2-oxopentyl]-1H-purin-6-one.
| Compound Name | 9-[(4R)-4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-hydroxy-2-oxopentyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 159810858 |
| Molecular Formula | C32H32N4O6 |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | 9-[(4R)-4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-hydroxy-2-oxopentyl]-1H-purin-6-one |
| SMILES | COc1ccc(C(OC[C@@H](CO)CC(=O)Cn2cnc3c(=O)[nH]cnc32)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H32N4O6/c1-40-27-12-8-24(9-13-27)32(23-6-4-3-5-7-23,25-10-14-28(41-2)15-11-25)42-19-22(18-37)16-26(38)17-36-21-35-29-30(36)33-20-34-31(29)39/h3-15,20-22,37H,16-19H2,1-2H3,(H,33,34,39)/t22-/m1/s1 |
| InChIKey | CUASPAURPOEBTM-JOCHJYFZSA-N |
| XLogP | 3.71 |
| TPSA | 128.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|