C31H33N3O7 — CID 15403823
N-[1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxypropan-2-yl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetamide (PubChem CID 15403823) has the molecular formula C31H33N3O7 and a molecular weight of 559.62 g/mol. Its IUPAC name is N-[1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxypropan-2-yl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetamide.
| Compound Name | N-[1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxypropan-2-yl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 15403823 |
| Molecular Formula | C31H33N3O7 |
| Molecular Weight | 559.62 g/mol |
| Exact Mass | 559.23 |
| IUPAC Name | N-[1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxypropan-2-yl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetamide |
| SMILES | COc1ccc(C(OCC(CO)NC(=O)Cn2cc(C)c(=O)[nH]c2=O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H33N3O7/c1-21-17-34(30(38)33-29(21)37)18-28(36)32-25(19-35)20-41-31(22-7-5-4-6-8-22,23-9-13-26(39-2)14-10-23)24-11-15-27(40-3)16-12-24/h4-17,25,35H,18-20H2,1-3H3,(H,32,36)(H,33,37,38) |
| InChIKey | CAPXOLGWYCEZQW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.62 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|