C40H51N6O7P — CID 70304764
N-[1-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphoryl]oxy-4-[[(4-methoxyphenyl)-diphenylmethyl]amino]butan-2-yl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetamide (PubChem CID 70304764) has the molecular formula C40H51N6O7P and a molecular weight of 758.86 g/mol. Its IUPAC name is N-[1-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphoryl]oxy-4-[[(4-methoxyphenyl)-diphenylmethyl]amino]butan-2-yl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetamide.
| Compound Name | N-[1-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphoryl]oxy-4-[[(4-methoxyphenyl)-diphenylmethyl]amino]butan-2-yl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 70304764 |
| Molecular Formula | C40H51N6O7P |
| Molecular Weight | 758.86 g/mol |
| Exact Mass | 758.36 |
| IUPAC Name | N-[1-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphoryl]oxy-4-[[(4-methoxyphenyl)-diphenylmethyl]amino]butan-2-yl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetamide |
| SMILES | COc1ccc(C(NCCC(COP(=O)(OCCC#N)N(C(C)C)C(C)C)NC(=O)Cn2cc(C)c(=O)[nH]c2=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C40H51N6O7P/c1-29(2)46(30(3)4)54(50,52-25-13-23-41)53-28-35(43-37(47)27-45-26-31(5)38(48)44-39(45)49)22-24-42-40(32-14-9-7-10-15-32,33-16-11-8-12-17-33)34-18-20-36(51-6)21-19-34/h7-12,14-21,26,29-30,35,42H,13,22,24-25,27-28H2,1-6H3,(H,43,47)(H,44,48,49) |
| InChIKey | STVMZDHAKGFQMC-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 167.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.86 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|