C37H40N2O8 — CID 102343807
3-[(3aS,7aR)-4,7-dimethyl-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]-N-[1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxypropan-2-yl]propanamide (PubChem CID 102343807) has the molecular formula C37H40N2O8 and a molecular weight of 640.73 g/mol. Its IUPAC name is 3-[(3aS,7aR)-4,7-dimethyl-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]-N-[1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxypropan-2-yl]propanamide.
| Compound Name | 3-[(3aS,7aR)-4,7-dimethyl-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]-N-[1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxypropan-2-yl]propanamide |
|---|---|
| PubChem CID | 102343807 |
| Molecular Formula | C37H40N2O8 |
| Molecular Weight | 640.73 g/mol |
| Exact Mass | 640.28 |
| IUPAC Name | 3-[(3aS,7aR)-4,7-dimethyl-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]-N-[1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxypropan-2-yl]propanamide |
| SMILES | COc1ccc(C(OCC(CO)NC(=O)CCN2C(=O)[C@@H]3[C@H](C2=O)C2(C)C=CC3(C)O2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H40N2O8/c1-35-19-20-36(2,47-35)32-31(35)33(42)39(34(32)43)21-18-30(41)38-27(22-40)23-46-37(24-8-6-5-7-9-24,25-10-14-28(44-3)15-11-25)26-12-16-29(45-4)17-13-26/h5-17,19-20,27,31-32,40H,18,21-23H2,1-4H3,(H,38,41)/t27?,31-,32+,35?,36? |
| InChIKey | ZZINJUOEKVYGPR-DFABNPDLSA-N |
| XLogP | 3.60 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.73 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|