C37H36N2O8 — CID 142497065
3-benzoyl-1-[2-[(2S)-1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxypropan-2-yl]oxyethyl]pyrimidine-2,4-dione (PubChem CID 142497065) has the molecular formula C37H36N2O8 and a molecular weight of 636.70 g/mol. Its IUPAC name is 3-benzoyl-1-[2-[(2S)-1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxypropan-2-yl]oxyethyl]pyrimidine-2,4-dione.
| Compound Name | 3-benzoyl-1-[2-[(2S)-1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxypropan-2-yl]oxyethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142497065 |
| Molecular Formula | C37H36N2O8 |
| Molecular Weight | 636.70 g/mol |
| Exact Mass | 636.25 |
| IUPAC Name | 3-benzoyl-1-[2-[(2S)-1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxypropan-2-yl]oxyethyl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@H](CO)OCCn2ccc(=O)n(C(=O)c3ccccc3)c2=O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H36N2O8/c1-44-31-17-13-29(14-18-31)37(28-11-7-4-8-12-28,30-15-19-32(45-2)20-16-30)47-26-33(25-40)46-24-23-38-22-21-34(41)39(36(38)43)35(42)27-9-5-3-6-10-27/h3-22,33,40H,23-26H2,1-2H3/t33-/m0/s1 |
| InChIKey | GTOKWTGPDWLMQY-XIFFEERXSA-N |
| XLogP | 4.10 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.70 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|