C23H18N2O4 — CID 132500082
3-benzoyl-1-(2-naphthalen-2-yloxyethyl)pyrimidine-2,4-dione (PubChem CID 132500082) has the molecular formula C23H18N2O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is 3-benzoyl-1-(2-naphthalen-2-yloxyethyl)pyrimidine-2,4-dione.
| Compound Name | 3-benzoyl-1-(2-naphthalen-2-yloxyethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 132500082 |
| Molecular Formula | C23H18N2O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 3-benzoyl-1-(2-naphthalen-2-yloxyethyl)pyrimidine-2,4-dione |
| SMILES | O=C(c1ccccc1)n1c(=O)ccn(CCOc2ccc3ccccc3c2)c1=O |
| InChI | InChI=1S/C23H18N2O4/c26-21-12-13-24(23(28)25(21)22(27)18-7-2-1-3-8-18)14-15-29-20-11-10-17-6-4-5-9-19(17)16-20/h1-13,16H,14-15H2 |
| InChIKey | IHYHRFXBUJLAPG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |