C50H47N5O6 — CID 67883718
2-[[2-(N-benzhydryl-4-methoxyanilino)-6-methoxypurin-9-yl]methoxy]-3-[(4-methoxyphenyl)-diphenylmethoxy]propan-1-ol (PubChem CID 67883718) has the molecular formula C50H47N5O6 and a molecular weight of 813.96 g/mol. Its IUPAC name is 2-[[2-(N-benzhydryl-4-methoxyanilino)-6-methoxypurin-9-yl]methoxy]-3-[(4-methoxyphenyl)-diphenylmethoxy]propan-1-ol.
| Compound Name | 2-[[2-(N-benzhydryl-4-methoxyanilino)-6-methoxypurin-9-yl]methoxy]-3-[(4-methoxyphenyl)-diphenylmethoxy]propan-1-ol |
|---|---|
| PubChem CID | 67883718 |
| Molecular Formula | C50H47N5O6 |
| Molecular Weight | 813.96 g/mol |
| Exact Mass | 813.35 |
| IUPAC Name | 2-[[2-(N-benzhydryl-4-methoxyanilino)-6-methoxypurin-9-yl]methoxy]-3-[(4-methoxyphenyl)-diphenylmethoxy]propan-1-ol |
| SMILES | COc1ccc(N(c2nc(OC)c3ncn(COC(CO)COC(c4ccccc4)(c4ccccc4)c4ccc(OC)cc4)c3n2)C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C50H47N5O6/c1-57-42-28-24-40(25-29-42)50(38-20-12-6-13-21-38,39-22-14-7-15-23-39)61-33-44(32-56)60-35-54-34-51-45-47(54)52-49(53-48(45)59-3)55(41-26-30-43(58-2)31-27-41)46(36-16-8-4-9-17-36)37-18-10-5-11-19-37/h4-31,34,44,46,56H,32-33,35H2,1-3H3 |
| InChIKey | MIUGVZPWAZDQFE-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.96 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|