C31H33N5O4 — CID 142302814
1-(6-amino-2-methylpurin-9-yl)-3-methoxy-4-[(4-methoxyphenyl)-diphenylmethoxy]butan-2-ol (PubChem CID 142302814) has the molecular formula C31H33N5O4 and a molecular weight of 539.64 g/mol. Its IUPAC name is 1-(6-amino-2-methylpurin-9-yl)-3-methoxy-4-[(4-methoxyphenyl)-diphenylmethoxy]butan-2-ol.
| Compound Name | 1-(6-amino-2-methylpurin-9-yl)-3-methoxy-4-[(4-methoxyphenyl)-diphenylmethoxy]butan-2-ol |
|---|---|
| PubChem CID | 142302814 |
| Molecular Formula | C31H33N5O4 |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | 1-(6-amino-2-methylpurin-9-yl)-3-methoxy-4-[(4-methoxyphenyl)-diphenylmethoxy]butan-2-ol |
| SMILES | COc1ccc(C(OCC(OC)C(O)Cn2cnc3c(N)nc(C)nc32)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H33N5O4/c1-21-34-29(32)28-30(35-21)36(20-33-28)18-26(37)27(39-3)19-40-31(22-10-6-4-7-11-22,23-12-8-5-9-13-23)24-14-16-25(38-2)17-15-24/h4-17,20,26-27,37H,18-19H2,1-3H3,(H2,32,34,35) |
| InChIKey | FLUROPYVROEQOU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|