C45H41N7O7 — CID 122377010
N-[2-benzamido-9-[2-[[(2R)-1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxypropan-2-yl]amino]-2-oxoethyl]purin-6-yl]benzamide (PubChem CID 122377010) has the molecular formula C45H41N7O7 and a molecular weight of 791.87 g/mol. Its IUPAC name is N-[2-benzamido-9-[2-[[(2R)-1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxypropan-2-yl]amino]-2-oxoethyl]purin-6-yl]benzamide.
| Compound Name | N-[2-benzamido-9-[2-[[(2R)-1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxypropan-2-yl]amino]-2-oxoethyl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 122377010 |
| Molecular Formula | C45H41N7O7 |
| Molecular Weight | 791.87 g/mol |
| Exact Mass | 791.31 |
| IUPAC Name | N-[2-benzamido-9-[2-[[(2R)-1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxypropan-2-yl]amino]-2-oxoethyl]purin-6-yl]benzamide |
| SMILES | COc1ccc(C(OC[C@@H](CO)NC(=O)Cn2cnc3c(NC(=O)c4ccccc4)nc(NC(=O)c4ccccc4)nc32)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C45H41N7O7/c1-57-36-22-18-33(19-23-36)45(32-16-10-5-11-17-32,34-20-24-37(58-2)25-21-34)59-28-35(27-53)47-38(54)26-52-29-46-39-40(48-42(55)30-12-6-3-7-13-30)49-44(50-41(39)52)51-43(56)31-14-8-4-9-15-31/h3-25,29,35,53H,26-28H2,1-2H3,(H,47,54)(H2,48,49,50,51,55,56)/t35-/m1/s1 |
| InChIKey | ZKHNWQACHRLGMA-PGUFJCEWSA-N |
| XLogP | 5.83 |
| TPSA | 178.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.87 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|