C40H37FN6O5 — CID 102397694
(Z)-5-(6-benzamidopurin-9-yl)-3-[2-[[bis(4-methoxyphenyl)-phenylmethyl]amino]ethyl]-4-fluoropent-3-enoic acid (PubChem CID 102397694) has the molecular formula C40H37FN6O5 and a molecular weight of 700.77 g/mol. Its IUPAC name is (Z)-5-(6-benzamidopurin-9-yl)-3-[2-[[bis(4-methoxyphenyl)-phenylmethyl]amino]ethyl]-4-fluoropent-3-enoic acid.
| Compound Name | (Z)-5-(6-benzamidopurin-9-yl)-3-[2-[[bis(4-methoxyphenyl)-phenylmethyl]amino]ethyl]-4-fluoropent-3-enoic acid |
|---|---|
| PubChem CID | 102397694 |
| Molecular Formula | C40H37FN6O5 |
| Molecular Weight | 700.77 g/mol |
| Exact Mass | 700.28 |
| IUPAC Name | (Z)-5-(6-benzamidopurin-9-yl)-3-[2-[[bis(4-methoxyphenyl)-phenylmethyl]amino]ethyl]-4-fluoropent-3-enoic acid |
| SMILES | COc1ccc(C(NCC/C(CC(=O)O)=C(/F)Cn2cnc3c(NC(=O)c4ccccc4)ncnc32)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C40H37FN6O5/c1-51-32-17-13-30(14-18-32)40(29-11-7-4-8-12-29,31-15-19-33(52-2)20-16-31)45-22-21-28(23-35(48)49)34(41)24-47-26-44-36-37(42-25-43-38(36)47)46-39(50)27-9-5-3-6-10-27/h3-20,25-26,45H,21-24H2,1-2H3,(H,48,49)(H,42,43,46,50)/b34-28- |
| InChIKey | AHIYCMSOGWHHJR-BFYITVNDSA-N |
| XLogP | 6.77 |
| TPSA | 140.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.77 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|