C45H39N5O7 — CID 142650677
N-[9-[(2S,4S,5R)-2-benzoyl-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]purin-6-yl]benzamide (PubChem CID 142650677) has the molecular formula C45H39N5O7 and a molecular weight of 761.84 g/mol. Its IUPAC name is N-[9-[(2S,4S,5R)-2-benzoyl-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2S,4S,5R)-2-benzoyl-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 142650677 |
| Molecular Formula | C45H39N5O7 |
| Molecular Weight | 761.84 g/mol |
| Exact Mass | 761.28 |
| IUPAC Name | N-[9-[(2S,4S,5R)-2-benzoyl-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]purin-6-yl]benzamide |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@](C(=O)c3ccccc3)(n3cnc4c(NC(=O)c5ccccc5)ncnc43)C[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C45H39N5O7/c1-54-35-22-18-33(19-23-35)45(32-16-10-5-11-17-32,34-20-24-36(55-2)25-21-34)56-27-38-37(51)26-44(57-38,40(52)30-12-6-3-7-13-30)50-29-48-39-41(46-28-47-42(39)50)49-43(53)31-14-8-4-9-15-31/h3-25,28-29,37-38,51H,26-27H2,1-2H3,(H,46,47,49,53)/t37-,38+,44-/m0/s1 |
| InChIKey | RFQIXPLCUVBGAD-CGVGRVIESA-N |
| XLogP | 6.79 |
| TPSA | 146.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.84 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|