C37H32FN5O6 — CID 175033550
N-[9-[(2R,3R,4R)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-4-fluoro-2-(hydroxymethyl)oxetan-2-yl]purin-6-yl]benzamide (PubChem CID 175033550) has the molecular formula C37H32FN5O6 and a molecular weight of 661.69 g/mol. Its IUPAC name is N-[9-[(2R,3R,4R)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-4-fluoro-2-(hydroxymethyl)oxetan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4R)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-4-fluoro-2-(hydroxymethyl)oxetan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 175033550 |
| Molecular Formula | C37H32FN5O6 |
| Molecular Weight | 661.69 g/mol |
| Exact Mass | 661.23 |
| IUPAC Name | N-[9-[(2R,3R,4R)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-4-fluoro-2-(hydroxymethyl)oxetan-2-yl]purin-6-yl]benzamide |
| SMILES | COc1ccc(C(O[C@H]2[C@@H](F)O[C@@]2(CO)n2cnc3c(NC(=O)c4ccccc4)ncnc32)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H32FN5O6/c1-46-28-17-13-26(14-18-28)37(25-11-7-4-8-12-25,27-15-19-29(47-2)20-16-27)48-31-32(38)49-36(31,21-44)43-23-41-30-33(39-22-40-34(30)43)42-35(45)24-9-5-3-6-10-24/h3-20,22-23,31-32,44H,21H2,1-2H3,(H,39,40,42,45)/t31-,32-,36+/m0/s1 |
| InChIKey | OVXJIEWAKUHMOO-PFDXXMEMSA-N |
| XLogP | 5.44 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.69 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|