C39H35N5O7 — CID 154685348
N-[9-[(2R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(hydroxymethoxy)-2,3-dihydrofuran-2-yl]purin-6-yl]benzamide (PubChem CID 154685348) has the molecular formula C39H35N5O7 and a molecular weight of 685.74 g/mol. Its IUPAC name is N-[9-[(2R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(hydroxymethoxy)-2,3-dihydrofuran-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(hydroxymethoxy)-2,3-dihydrofuran-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 154685348 |
| Molecular Formula | C39H35N5O7 |
| Molecular Weight | 685.74 g/mol |
| Exact Mass | 685.25 |
| IUPAC Name | N-[9-[(2R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(hydroxymethoxy)-2,3-dihydrofuran-2-yl]purin-6-yl]benzamide |
| SMILES | COc1ccc(C(OCC2=CC(OCO)[C@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)O2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C39H35N5O7/c1-47-30-17-13-28(14-18-30)39(27-11-7-4-8-12-27,29-15-19-31(48-2)20-16-29)50-22-32-21-33(49-25-45)38(51-32)44-24-42-34-35(40-23-41-36(34)44)43-37(46)26-9-5-3-6-10-26/h3-21,23-24,33,38,45H,22,25H2,1-2H3,(H,40,41,43,46)/t33?,38-/m1/s1 |
| InChIKey | IDXOYEKWGQBNJX-XNGJMDCKSA-N |
| XLogP | 5.85 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.74 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|