C43H45N5O5Si — CID 14805390
N-[9-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-2,3-dihydrofuran-2-yl]purin-6-yl]benzamide (PubChem CID 14805390) has the molecular formula C43H45N5O5Si and a molecular weight of 739.95 g/mol. Its IUPAC name is N-[9-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-2,3-dihydrofuran-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-2,3-dihydrofuran-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 14805390 |
| Molecular Formula | C43H45N5O5Si |
| Molecular Weight | 739.95 g/mol |
| Exact Mass | 739.32 |
| IUPAC Name | N-[9-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-2,3-dihydrofuran-2-yl]purin-6-yl]benzamide |
| SMILES | COc1ccc(C(OCC2=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)O2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C43H45N5O5Si/c1-42(2,3)54(5,6)53-36-26-35(52-41(36)48-29-46-37-38(44-28-45-39(37)48)47-40(49)30-16-10-7-11-17-30)27-51-43(31-18-12-8-13-19-31,32-20-14-9-15-21-32)33-22-24-34(50-4)25-23-33/h7-26,28-29,36,41H,27H2,1-6H3,(H,44,45,47,49)/t36-,41-/m1/s1 |
| InChIKey | JIXMFNNNFJMHNS-PDGFCRNHSA-N |
| XLogP | 8.90 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.95 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|