C43H45N5O4Si — CID 10556841
N-[9-[(2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylidene-5-(trityloxymethyl)oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 10556841) has the molecular formula C43H45N5O4Si and a molecular weight of 723.95 g/mol. Its IUPAC name is N-[9-[(2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylidene-5-(trityloxymethyl)oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylidene-5-(trityloxymethyl)oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 10556841 |
| Molecular Formula | C43H45N5O4Si |
| Molecular Weight | 723.95 g/mol |
| Exact Mass | 723.32 |
| IUPAC Name | N-[9-[(2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylidene-5-(trityloxymethyl)oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | C=C1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)O[C@@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H45N5O4Si/c1-30-35(27-50-43(32-21-13-8-14-22-32,33-23-15-9-16-24-33)34-25-17-10-18-26-34)51-41(37(30)52-53(5,6)42(2,3)4)48-29-46-36-38(44-28-45-39(36)48)47-40(49)31-19-11-7-12-20-31/h7-26,28-29,35,37,41H,1,27H2,2-6H3,(H,44,45,47,49)/t35-,37-,41-/m1/s1 |
| InChIKey | DLQGDWULDRZHSC-XPISCRBJSA-N |
| XLogP | 8.93 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.95 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|