C38H34FN5O6 — CID 57300392
N-[9-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-[1-hydroxy-2,2-bis(4-methoxyphenyl)-2-phenylethyl]oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 57300392) has the molecular formula C38H34FN5O6 and a molecular weight of 675.72 g/mol. Its IUPAC name is N-[9-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-[1-hydroxy-2,2-bis(4-methoxyphenyl)-2-phenylethyl]oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-[1-hydroxy-2,2-bis(4-methoxyphenyl)-2-phenylethyl]oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 57300392 |
| Molecular Formula | C38H34FN5O6 |
| Molecular Weight | 675.72 g/mol |
| Exact Mass | 675.25 |
| IUPAC Name | N-[9-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-[1-hydroxy-2,2-bis(4-methoxyphenyl)-2-phenylethyl]oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | COc1ccc(C(c2ccccc2)(c2ccc(OC)cc2)C(O)[C@H]2O[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)[C@H](F)[C@@H]2O)cc1 |
| InChI | InChI=1S/C38H34FN5O6/c1-48-27-17-13-25(14-18-27)38(24-11-7-4-8-12-24,26-15-19-28(49-2)20-16-26)33(46)32-31(45)29(39)37(50-32)44-22-42-30-34(40-21-41-35(30)44)43-36(47)23-9-5-3-6-10-23/h3-22,29,31-33,37,45-46H,1-2H3,(H,40,41,43,47)/t29-,31+,32+,33?,37-/m1/s1 |
| InChIKey | WYTOYNBTICHAAC-GCNQJIDRSA-N |
| XLogP | 5.09 |
| TPSA | 140.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.72 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|