C39H36FN5O8S — CID 101029588
[(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-4-fluoro-2-[1-hydroxy-2,2-bis(4-methoxyphenyl)-2-phenylethyl]oxolan-3-yl] methanesulfonate (PubChem CID 101029588) has the molecular formula C39H36FN5O8S and a molecular weight of 753.81 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-4-fluoro-2-[1-hydroxy-2,2-bis(4-methoxyphenyl)-2-phenylethyl]oxolan-3-yl] methanesulfonate.
| Compound Name | [(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-4-fluoro-2-[1-hydroxy-2,2-bis(4-methoxyphenyl)-2-phenylethyl]oxolan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 101029588 |
| Molecular Formula | C39H36FN5O8S |
| Molecular Weight | 753.81 g/mol |
| Exact Mass | 753.23 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-4-fluoro-2-[1-hydroxy-2,2-bis(4-methoxyphenyl)-2-phenylethyl]oxolan-3-yl] methanesulfonate |
| SMILES | COc1ccc(C(c2ccccc2)(c2ccc(OC)cc2)C(O)[C@H]2O[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)[C@H](F)[C@@H]2OS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C39H36FN5O8S/c1-50-28-18-14-26(15-19-28)39(25-12-8-5-9-13-25,27-16-20-29(51-2)21-17-27)34(46)33-32(53-54(3,48)49)30(40)38(52-33)45-23-43-31-35(41-22-42-36(31)45)44-37(47)24-10-6-4-7-11-24/h4-23,30,32-34,38,46H,1-3H3,(H,41,42,44,47)/t30-,32+,33+,34?,38-/m1/s1 |
| InChIKey | IQMAVPKJMOVVCT-MHLRQMQDSA-N |
| XLogP | 5.07 |
| TPSA | 163.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.81 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|