C39H37N5O7 — CID 53249237
N-[9-[(2R,3R,4R,5R)-5-[2-(2,3-dimethoxyphenyl)-1-hydroxy-2,2-diphenylethyl]-4-hydroxy-3-methoxyoxolan-2-yl]purin-6-yl]benzamide (PubChem CID 53249237) has the molecular formula C39H37N5O7 and a molecular weight of 687.75 g/mol. Its IUPAC name is N-[9-[(2R,3R,4R,5R)-5-[2-(2,3-dimethoxyphenyl)-1-hydroxy-2,2-diphenylethyl]-4-hydroxy-3-methoxyoxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4R,5R)-5-[2-(2,3-dimethoxyphenyl)-1-hydroxy-2,2-diphenylethyl]-4-hydroxy-3-methoxyoxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 53249237 |
| Molecular Formula | C39H37N5O7 |
| Molecular Weight | 687.75 g/mol |
| Exact Mass | 687.27 |
| IUPAC Name | N-[9-[(2R,3R,4R,5R)-5-[2-(2,3-dimethoxyphenyl)-1-hydroxy-2,2-diphenylethyl]-4-hydroxy-3-methoxyoxolan-2-yl]purin-6-yl]benzamide |
| SMILES | COc1cccc(C(c2ccccc2)(c2ccccc2)C(O)[C@H]2O[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)[C@H](OC)[C@@H]2O)c1OC |
| InChI | InChI=1S/C39H37N5O7/c1-48-28-21-13-20-27(31(28)49-2)39(25-16-9-5-10-17-25,26-18-11-6-12-19-26)34(46)32-30(45)33(50-3)38(51-32)44-23-42-29-35(40-22-41-36(29)44)43-37(47)24-14-7-4-8-15-24/h4-23,30,32-34,38,45-46H,1-3H3,(H,40,41,43,47)/t30-,32+,33-,34?,38-/m1/s1 |
| InChIKey | VACQXUVGQLBRDW-GEUPBERBSA-N |
| XLogP | 4.76 |
| TPSA | 150.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.75 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|