C33H33N5O7 — CID 67281464
N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[1-hydroxy-2,2-bis(2-methoxyphenyl)-2-phenylethyl]oxolan-2-yl]purin-6-yl]acetamide (PubChem CID 67281464) has the molecular formula C33H33N5O7 and a molecular weight of 611.66 g/mol. Its IUPAC name is N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[1-hydroxy-2,2-bis(2-methoxyphenyl)-2-phenylethyl]oxolan-2-yl]purin-6-yl]acetamide.
| Compound Name | N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[1-hydroxy-2,2-bis(2-methoxyphenyl)-2-phenylethyl]oxolan-2-yl]purin-6-yl]acetamide |
|---|---|
| PubChem CID | 67281464 |
| Molecular Formula | C33H33N5O7 |
| Molecular Weight | 611.66 g/mol |
| Exact Mass | 611.24 |
| IUPAC Name | N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[1-hydroxy-2,2-bis(2-methoxyphenyl)-2-phenylethyl]oxolan-2-yl]purin-6-yl]acetamide |
| SMILES | COc1ccccc1C(c1ccccc1)(c1ccccc1OC)C(O)[C@H]1O[C@@H](n2cnc3c(NC(C)=O)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C33H33N5O7/c1-19(39)37-30-25-31(35-17-34-30)38(18-36-25)32-27(41)26(40)28(45-32)29(42)33(20-11-5-4-6-12-20,21-13-7-9-15-23(21)43-2)22-14-8-10-16-24(22)44-3/h4-18,26-29,32,40-42H,1-3H3,(H,34,35,37,39)/t26-,27+,28-,29?,32+/m0/s1 |
| InChIKey | DIYIPBHANANHBQ-PFZLBRBPSA-N |
| XLogP | 2.82 |
| TPSA | 161.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.66 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|