C54H52N6O6 — CID 21145682
(2R,3R,5S)-5-[1-hydroxy-2-(4-methoxyphenyl)-2,2-diphenylethyl]-2-[6-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-4-morpholin-4-yloxolan-3-ol (PubChem CID 21145682) has the molecular formula C54H52N6O6 and a molecular weight of 881.05 g/mol. Its IUPAC name is (2R,3R,5S)-5-[1-hydroxy-2-(4-methoxyphenyl)-2,2-diphenylethyl]-2-[6-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-4-morpholin-4-yloxolan-3-ol.
| Compound Name | (2R,3R,5S)-5-[1-hydroxy-2-(4-methoxyphenyl)-2,2-diphenylethyl]-2-[6-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-4-morpholin-4-yloxolan-3-ol |
|---|---|
| PubChem CID | 21145682 |
| Molecular Formula | C54H52N6O6 |
| Molecular Weight | 881.05 g/mol |
| Exact Mass | 880.39 |
| IUPAC Name | (2R,3R,5S)-5-[1-hydroxy-2-(4-methoxyphenyl)-2,2-diphenylethyl]-2-[6-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-4-morpholin-4-yloxolan-3-ol |
| SMILES | COc1ccc(C(Nc2ncnc3c2ncn3[C@@H]2O[C@H](C(O)C(c3ccccc3)(c3ccccc3)c3ccc(OC)cc3)C(N3CCOCC3)[C@H]2O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C54H52N6O6/c1-63-43-27-23-39(24-28-43)53(37-15-7-3-8-16-37,38-17-9-4-10-18-38)49(62)48-46(59-31-33-65-34-32-59)47(61)52(66-48)60-36-57-45-50(55-35-56-51(45)60)58-54(40-19-11-5-12-20-40,41-21-13-6-14-22-41)42-25-29-44(64-2)30-26-42/h3-30,35-36,46-49,52,61-62H,31-34H2,1-2H3,(H,55,56,58)/t46?,47-,48+,49?,52-/m1/s1 |
| InChIKey | XIRMDOVEZMMRPI-PNZOEYLCSA-N |
| XLogP | 7.60 |
| TPSA | 136.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.05 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|