C40H38N6O6 — CID 67655746
N-[9-[2-acetyl-5-[[(2,3-dimethoxyphenyl)-diphenylmethoxy]methyl]-3-hydroxypyrrolidin-1-yl]purin-6-yl]benzamide (PubChem CID 67655746) has the molecular formula C40H38N6O6 and a molecular weight of 698.78 g/mol. Its IUPAC name is N-[9-[2-acetyl-5-[[(2,3-dimethoxyphenyl)-diphenylmethoxy]methyl]-3-hydroxypyrrolidin-1-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[2-acetyl-5-[[(2,3-dimethoxyphenyl)-diphenylmethoxy]methyl]-3-hydroxypyrrolidin-1-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 67655746 |
| Molecular Formula | C40H38N6O6 |
| Molecular Weight | 698.78 g/mol |
| Exact Mass | 698.29 |
| IUPAC Name | N-[9-[2-acetyl-5-[[(2,3-dimethoxyphenyl)-diphenylmethoxy]methyl]-3-hydroxypyrrolidin-1-yl]purin-6-yl]benzamide |
| SMILES | COc1cccc(C(OCC2CC(O)C(C(C)=O)N2n2cnc3c(NC(=O)c4ccccc4)ncnc32)(c2ccccc2)c2ccccc2)c1OC |
| InChI | InChI=1S/C40H38N6O6/c1-26(47)35-32(48)22-30(46(35)45-25-43-34-37(41-24-42-38(34)45)44-39(49)27-14-7-4-8-15-27)23-52-40(28-16-9-5-10-17-28,29-18-11-6-12-19-29)31-20-13-21-33(50-2)36(31)51-3/h4-21,24-25,30,32,35,48H,22-23H2,1-3H3,(H,41,42,44,49) |
| InChIKey | YLNTUJVPHAKMGT-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 140.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.78 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|