C39H40N4O7 — CID 67655154
3-[2-acetyl-5-[[(2,3-dimethoxyphenyl)-diphenylmethoxy]methyl]-3-hydroxypyrrolidin-1-yl]-6-amino-6-benzoyl-1H-pyrimidin-2-one (PubChem CID 67655154) has the molecular formula C39H40N4O7 and a molecular weight of 676.77 g/mol. Its IUPAC name is 3-[2-acetyl-5-[[(2,3-dimethoxyphenyl)-diphenylmethoxy]methyl]-3-hydroxypyrrolidin-1-yl]-6-amino-6-benzoyl-1H-pyrimidin-2-one.
| Compound Name | 3-[2-acetyl-5-[[(2,3-dimethoxyphenyl)-diphenylmethoxy]methyl]-3-hydroxypyrrolidin-1-yl]-6-amino-6-benzoyl-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 67655154 |
| Molecular Formula | C39H40N4O7 |
| Molecular Weight | 676.77 g/mol |
| Exact Mass | 676.29 |
| IUPAC Name | 3-[2-acetyl-5-[[(2,3-dimethoxyphenyl)-diphenylmethoxy]methyl]-3-hydroxypyrrolidin-1-yl]-6-amino-6-benzoyl-1H-pyrimidin-2-one |
| SMILES | COc1cccc(C(OCC2CC(O)C(C(C)=O)N2N2C=CC(N)(C(=O)c3ccccc3)NC2=O)(c2ccccc2)c2ccccc2)c1OC |
| InChI | InChI=1S/C39H40N4O7/c1-26(44)34-32(45)24-30(43(34)42-23-22-38(40,41-37(42)47)36(46)27-14-7-4-8-15-27)25-50-39(28-16-9-5-10-17-28,29-18-11-6-12-19-29)31-20-13-21-33(48-2)35(31)49-3/h4-23,30,32,34,45H,24-25,40H2,1-3H3,(H,41,47) |
| InChIKey | ZPFNQEITDYDUAK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 143.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.77 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|