C39H36FN5O8 — CID 91493913
N-[9-[(2R,3S,4R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]-fluoromethyl]-3,4-dihydroxy-3-methoxyoxolan-2-yl]purin-6-yl]benzamide (PubChem CID 91493913) has the molecular formula C39H36FN5O8 and a molecular weight of 721.74 g/mol. Its IUPAC name is N-[9-[(2R,3S,4R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]-fluoromethyl]-3,4-dihydroxy-3-methoxyoxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3S,4R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]-fluoromethyl]-3,4-dihydroxy-3-methoxyoxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 91493913 |
| Molecular Formula | C39H36FN5O8 |
| Molecular Weight | 721.74 g/mol |
| Exact Mass | 721.25 |
| IUPAC Name | N-[9-[(2R,3S,4R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]-fluoromethyl]-3,4-dihydroxy-3-methoxyoxolan-2-yl]purin-6-yl]benzamide |
| SMILES | COc1ccc(C(OC(F)[C@H]2O[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)[C@@](O)(OC)[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C39H36FN5O8/c1-49-28-18-14-26(15-19-28)38(25-12-8-5-9-13-25,27-16-20-29(50-2)21-17-27)53-33(40)31-32(46)39(48,51-3)37(52-31)45-23-43-30-34(41-22-42-35(30)45)44-36(47)24-10-6-4-7-11-24/h4-23,31-33,37,46,48H,1-3H3,(H,41,42,44,47)/t31-,32+,33?,37+,39-/m0/s1 |
| InChIKey | RLVIMYPIPXMCSH-BQHNRKGTSA-N |
| XLogP | 4.99 |
| TPSA | 159.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.74 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|