C28H28N2O6 — CID 170329075
3-[3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-hydroxypropyl]-1H-pyrimidine-2,4-dione (PubChem CID 170329075) has the molecular formula C28H28N2O6 and a molecular weight of 488.54 g/mol. Its IUPAC name is 3-[3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-hydroxypropyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 3-[3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-hydroxypropyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 170329075 |
| Molecular Formula | C28H28N2O6 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 3-[3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-hydroxypropyl]-1H-pyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OCC(O)Cn2c(=O)cc[nH]c2=O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C28H28N2O6/c1-34-24-12-8-21(9-13-24)28(20-6-4-3-5-7-20,22-10-14-25(35-2)15-11-22)36-19-23(31)18-30-26(32)16-17-29-27(30)33/h3-17,23,31H,18-19H2,1-2H3,(H,29,33) |
| InChIKey | UJJJTOCFDDPHKJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|