C31H40N2O5 — CID 68809639
6-amino-N-[1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxybutan-2-yl]hexanamide (PubChem CID 68809639) has the molecular formula C31H40N2O5 and a molecular weight of 520.67 g/mol. Its IUPAC name is 6-amino-N-[1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxybutan-2-yl]hexanamide.
| Compound Name | 6-amino-N-[1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxybutan-2-yl]hexanamide |
|---|---|
| PubChem CID | 68809639 |
| Molecular Formula | C31H40N2O5 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | 6-amino-N-[1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxybutan-2-yl]hexanamide |
| SMILES | COc1ccc(C(OCC(NC(=O)CCCCCN)C(C)O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H40N2O5/c1-23(34)29(33-30(35)12-8-5-9-21-32)22-38-31(24-10-6-4-7-11-24,25-13-17-27(36-2)18-14-25)26-15-19-28(37-3)20-16-26/h4,6-7,10-11,13-20,23,29,34H,5,8-9,12,21-22,32H2,1-3H3,(H,33,35) |
| InChIKey | WXKWCRLMRCRMKG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|