C40H52N2O8 — CID 177254517
methyl 12-[[(2S,3R)-1-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethylamino]-3-hydroxy-1-oxobutan-2-yl]amino]-12-oxododec-2-enoate (PubChem CID 177254517) has the molecular formula C40H52N2O8 and a molecular weight of 688.86 g/mol. Its IUPAC name is methyl 12-[[(2S,3R)-1-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethylamino]-3-hydroxy-1-oxobutan-2-yl]amino]-12-oxododec-2-enoate.
| Compound Name | methyl 12-[[(2S,3R)-1-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethylamino]-3-hydroxy-1-oxobutan-2-yl]amino]-12-oxododec-2-enoate |
|---|---|
| PubChem CID | 177254517 |
| Molecular Formula | C40H52N2O8 |
| Molecular Weight | 688.86 g/mol |
| Exact Mass | 688.37 |
| IUPAC Name | methyl 12-[[(2S,3R)-1-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethylamino]-3-hydroxy-1-oxobutan-2-yl]amino]-12-oxododec-2-enoate |
| SMILES | COC(=O)C=CCCCCCCCCC(=O)N[C@H](C(=O)NCCOC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1)[C@@H](C)O |
| InChI | InChI=1S/C40H52N2O8/c1-30(43)38(42-36(44)18-14-9-7-5-6-8-10-15-19-37(45)49-4)39(46)41-28-29-50-40(31-16-12-11-13-17-31,32-20-24-34(47-2)25-21-32)33-22-26-35(48-3)27-23-33/h11-13,15-17,19-27,30,38,43H,5-10,14,18,28-29H2,1-4H3,(H,41,46)(H,42,44)/t30-,38+/m1/s1 |
| InChIKey | JUBAXKZMTUEGKI-KLFBTDGFSA-N |
| XLogP | 5.84 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.86 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|