C41H58O4 — CID 68745223
(E)-1-[bis(4-methoxyphenyl)-phenylmethoxy]icos-11-en-3-ol (PubChem CID 68745223) has the molecular formula C41H58O4 and a molecular weight of 614.91 g/mol. Its IUPAC name is (E)-1-[bis(4-methoxyphenyl)-phenylmethoxy]icos-11-en-3-ol.
| Compound Name | (E)-1-[bis(4-methoxyphenyl)-phenylmethoxy]icos-11-en-3-ol |
|---|---|
| PubChem CID | 68745223 |
| Molecular Formula | C41H58O4 |
| Molecular Weight | 614.91 g/mol |
| Exact Mass | 614.43 |
| IUPAC Name | (E)-1-[bis(4-methoxyphenyl)-phenylmethoxy]icos-11-en-3-ol |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(O)CCOC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C41H58O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-24-38(42)33-34-45-41(35-22-19-18-20-23-35,36-25-29-39(43-2)30-26-36)37-27-31-40(44-3)32-28-37/h11-12,18-20,22-23,25-32,38,42H,4-10,13-17,21,24,33-34H2,1-3H3/b12-11+ |
| InChIKey | NYZXNXCHBWUALM-VAWYXSNFSA-N |
| XLogP | 10.80 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.91 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|