C33H43N3O8 — CID 131741574
2-[2-(6-hydroxyhexanoyl)hydrazinyl]acetic acid;4-methoxy-2-[(4-methoxyphenyl)-diphenylmethoxy]butanamide (PubChem CID 131741574) has the molecular formula C33H43N3O8 and a molecular weight of 609.72 g/mol. Its IUPAC name is 2-[2-(6-hydroxyhexanoyl)hydrazinyl]acetic acid;4-methoxy-2-[(4-methoxyphenyl)-diphenylmethoxy]butanamide.
| Compound Name | 2-[2-(6-hydroxyhexanoyl)hydrazinyl]acetic acid;4-methoxy-2-[(4-methoxyphenyl)-diphenylmethoxy]butanamide |
|---|---|
| PubChem CID | 131741574 |
| Molecular Formula | C33H43N3O8 |
| Molecular Weight | 609.72 g/mol |
| Exact Mass | 609.31 |
| IUPAC Name | 2-[2-(6-hydroxyhexanoyl)hydrazinyl]acetic acid;4-methoxy-2-[(4-methoxyphenyl)-diphenylmethoxy]butanamide |
| SMILES | COCCC(OC(c1ccccc1)(c1ccccc1)c1ccc(OC)cc1)C(N)=O.O=C(O)CNNC(=O)CCCCCO |
| InChI | InChI=1S/C25H27NO4.C8H16N2O4/c1-28-18-17-23(24(26)27)30-25(19-9-5-3-6-10-19,20-11-7-4-8-12-20)21-13-15-22(29-2)16-14-21;11-5-3-1-2-4-7(12)10-9-6-8(13)14/h3-16,23H,17-18H2,1-2H3,(H2,26,27);9,11H,1-6H2,(H,10,12)(H,13,14) |
| InChIKey | NKLJXLZCOMVVEX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 169.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.72 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|