C35H50N5O8P — CID 175072276
amino-[[4-methoxy-4-[(4-methoxyphenyl)-diphenylmethoxy]butyl]amino]phosphinous acid;2-[[2-(2-hexanoylhydrazinyl)acetyl]amino]acetic acid (PubChem CID 175072276) has the molecular formula C35H50N5O8P and a molecular weight of 699.79 g/mol. Its IUPAC name is amino-[[4-methoxy-4-[(4-methoxyphenyl)-diphenylmethoxy]butyl]amino]phosphinous acid;2-[[2-(2-hexanoylhydrazinyl)acetyl]amino]acetic acid.
| Compound Name | amino-[[4-methoxy-4-[(4-methoxyphenyl)-diphenylmethoxy]butyl]amino]phosphinous acid;2-[[2-(2-hexanoylhydrazinyl)acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 175072276 |
| Molecular Formula | C35H50N5O8P |
| Molecular Weight | 699.79 g/mol |
| Exact Mass | 699.34 |
| IUPAC Name | amino-[[4-methoxy-4-[(4-methoxyphenyl)-diphenylmethoxy]butyl]amino]phosphinous acid;2-[[2-(2-hexanoylhydrazinyl)acetyl]amino]acetic acid |
| SMILES | CCCCCC(=O)NNCC(=O)NCC(=O)O.COc1ccc(C(OC(CCCNP(N)O)OC)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H31N2O4P.C10H19N3O4/c1-29-23-17-15-22(16-18-23)25(20-10-5-3-6-11-20,21-12-7-4-8-13-21)31-24(30-2)14-9-19-27-32(26)28;1-2-3-4-5-8(14)13-12-6-9(15)11-7-10(16)17/h3-8,10-13,15-18,24,27-28H,9,14,19,26H2,1-2H3;12H,2-7H2,1H3,(H,11,15)(H,13,14)(H,16,17) |
| InChIKey | VKIDWEJNEOUMFV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 193.50 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.79 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|