C49H68N2O7 — CID 169069376
[(3R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-1-[(Z)-octadec-9-enoyl]pyrrolidin-3-yl] 4-(methylamino)-4-oxobutanoate (PubChem CID 169069376) has the molecular formula C49H68N2O7 and a molecular weight of 797.09 g/mol. Its IUPAC name is [(3R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-1-[(Z)-octadec-9-enoyl]pyrrolidin-3-yl] 4-(methylamino)-4-oxobutanoate.
| Compound Name | [(3R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-1-[(Z)-octadec-9-enoyl]pyrrolidin-3-yl] 4-(methylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 169069376 |
| Molecular Formula | C49H68N2O7 |
| Molecular Weight | 797.09 g/mol |
| Exact Mass | 796.50 |
| IUPAC Name | [(3R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-1-[(Z)-octadec-9-enoyl]pyrrolidin-3-yl] 4-(methylamino)-4-oxobutanoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N1C[C@H](OC(=O)CCC(=O)NC)C[C@H]1COC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C49H68N2O7/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-25-47(53)51-37-45(58-48(54)35-34-46(52)50-2)36-42(51)38-57-49(39-23-20-19-21-24-39,40-26-30-43(55-3)31-27-40)41-28-32-44(56-4)33-29-41/h12-13,19-21,23-24,26-33,42,45H,5-11,14-18,22,25,34-38H2,1-4H3,(H,50,52)/b13-12-/t42-,45+/m0/s1 |
| InChIKey | SDWISAMSOSEFAO-NKYKHPSRSA-N |
| XLogP | 10.09 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.09 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|