C35H48N2O6 — CID 131736538
2-aminoacetic acid;4-methoxy-2-[(4-methoxyphenyl)-diphenylmethoxy]dodecanamide (PubChem CID 131736538) has the molecular formula C35H48N2O6 and a molecular weight of 592.78 g/mol. Its IUPAC name is 2-aminoacetic acid;4-methoxy-2-[(4-methoxyphenyl)-diphenylmethoxy]dodecanamide.
| Compound Name | 2-aminoacetic acid;4-methoxy-2-[(4-methoxyphenyl)-diphenylmethoxy]dodecanamide |
|---|---|
| PubChem CID | 131736538 |
| Molecular Formula | C35H48N2O6 |
| Molecular Weight | 592.78 g/mol |
| Exact Mass | 592.35 |
| IUPAC Name | 2-aminoacetic acid;4-methoxy-2-[(4-methoxyphenyl)-diphenylmethoxy]dodecanamide |
| SMILES | CCCCCCCCC(CC(OC(c1ccccc1)(c1ccccc1)c1ccc(OC)cc1)C(N)=O)OC.NCC(=O)O |
| InChI | InChI=1S/C33H43NO4.C2H5NO2/c1-4-5-6-7-8-15-20-30(37-3)25-31(32(34)35)38-33(26-16-11-9-12-17-26,27-18-13-10-14-19-27)28-21-23-29(36-2)24-22-28;3-1-2(4)5/h9-14,16-19,21-24,30-31H,4-8,15,20,25H2,1-3H3,(H2,34,35);1,3H2,(H,4,5) |
| InChIKey | IRCSWDLMDYBBRE-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 134.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.78 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|