C27H32N2O6 — CID 174730220
2-aminoacetic acid;4,4-dimethoxy-2-trityloxybutanamide (PubChem CID 174730220) has the molecular formula C27H32N2O6 and a molecular weight of 480.56 g/mol. Its IUPAC name is 2-aminoacetic acid;4,4-dimethoxy-2-trityloxybutanamide.
| Compound Name | 2-aminoacetic acid;4,4-dimethoxy-2-trityloxybutanamide |
|---|---|
| PubChem CID | 174730220 |
| Molecular Formula | C27H32N2O6 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 2-aminoacetic acid;4,4-dimethoxy-2-trityloxybutanamide |
| SMILES | COC(CC(OC(c1ccccc1)(c1ccccc1)c1ccccc1)C(N)=O)OC.NCC(=O)O |
| InChI | InChI=1S/C25H27NO4.C2H5NO2/c1-28-23(29-2)18-22(24(26)27)30-25(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21;3-1-2(4)5/h3-17,22-23H,18H2,1-2H3,(H2,26,27);1,3H2,(H,4,5) |
| InChIKey | UYAIWRQOEDNBJR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 134.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|