C28H32O11 — CID 54562469
ethyl 2,3,3,4,5,5,6,7-octahydroxy-7-trityloxyheptanoate (PubChem CID 54562469) has the molecular formula C28H32O11 and a molecular weight of 544.55 g/mol. Its IUPAC name is ethyl 2,3,3,4,5,5,6,7-octahydroxy-7-trityloxyheptanoate.
| Compound Name | ethyl 2,3,3,4,5,5,6,7-octahydroxy-7-trityloxyheptanoate |
|---|---|
| PubChem CID | 54562469 |
| Molecular Formula | C28H32O11 |
| Molecular Weight | 544.55 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | ethyl 2,3,3,4,5,5,6,7-octahydroxy-7-trityloxyheptanoate |
| SMILES | CCOC(=O)C(O)C(O)(O)C(O)C(O)(O)C(O)C(O)OC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H32O11/c1-2-38-23(31)21(29)27(34,35)25(33)28(36,37)22(30)24(32)39-26(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20/h3-17,21-22,24-25,29-30,32-37H,2H2,1H3 |
| InChIKey | ZRNAACODAZSUSQ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 197.37 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.55 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|