C25H26O4 — CID 141332550
3-methoxy-2,2-dimethyl-3-trityloxypropanoic acid (PubChem CID 141332550) has the molecular formula C25H26O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is 3-methoxy-2,2-dimethyl-3-trityloxypropanoic acid.
| Compound Name | 3-methoxy-2,2-dimethyl-3-trityloxypropanoic acid |
|---|---|
| PubChem CID | 141332550 |
| Molecular Formula | C25H26O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 3-methoxy-2,2-dimethyl-3-trityloxypropanoic acid |
| SMILES | COC(OC(c1ccccc1)(c1ccccc1)c1ccccc1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C25H26O4/c1-24(2,22(26)27)23(28-3)29-25(19-13-7-4-8-14-19,20-15-9-5-10-16-20)21-17-11-6-12-18-21/h4-18,23H,1-3H3,(H,26,27) |
| InChIKey | WLKDXZSRFXZIAZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|