C33H40O6 — CID 11114188
ditert-butyl 2-[(1S,2S)-1-hydroxy-2-trityloxypropyl]propanedioate (PubChem CID 11114188) has the molecular formula C33H40O6 and a molecular weight of 532.68 g/mol. Its IUPAC name is ditert-butyl 2-[(1S,2S)-1-hydroxy-2-trityloxypropyl]propanedioate.
| Compound Name | ditert-butyl 2-[(1S,2S)-1-hydroxy-2-trityloxypropyl]propanedioate |
|---|---|
| PubChem CID | 11114188 |
| Molecular Formula | C33H40O6 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | ditert-butyl 2-[(1S,2S)-1-hydroxy-2-trityloxypropyl]propanedioate |
| SMILES | C[C@H](OC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@@H](O)C(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H40O6/c1-23(28(34)27(29(35)38-31(2,3)4)30(36)39-32(5,6)7)37-33(24-17-11-8-12-18-24,25-19-13-9-14-20-25)26-21-15-10-16-22-26/h8-23,27-28,34H,1-7H3/t23-,28+/m0/s1 |
| InChIKey | IQSNKHRINRCGAL-NEKDWFFYSA-N |
| XLogP | 6.04 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|