C37H43NO4 — CID 10650616
tert-butyl (2S,3S,4S)-3-(benzylamino)-2-[(1R)-1-hydroxyethyl]-4-trityloxypentanoate (PubChem CID 10650616) has the molecular formula C37H43NO4 and a molecular weight of 565.75 g/mol. Its IUPAC name is tert-butyl (2S,3S,4S)-3-(benzylamino)-2-[(1R)-1-hydroxyethyl]-4-trityloxypentanoate.
| Compound Name | tert-butyl (2S,3S,4S)-3-(benzylamino)-2-[(1R)-1-hydroxyethyl]-4-trityloxypentanoate |
|---|---|
| PubChem CID | 10650616 |
| Molecular Formula | C37H43NO4 |
| Molecular Weight | 565.75 g/mol |
| Exact Mass | 565.32 |
| IUPAC Name | tert-butyl (2S,3S,4S)-3-(benzylamino)-2-[(1R)-1-hydroxyethyl]-4-trityloxypentanoate |
| SMILES | C[C@H](OC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@@H](NCc1ccccc1)[C@H](C(=O)OC(C)(C)C)[C@@H](C)O |
| InChI | InChI=1S/C37H43NO4/c1-27(39)33(35(40)42-36(3,4)5)34(38-26-29-18-10-6-11-19-29)28(2)41-37(30-20-12-7-13-21-30,31-22-14-8-15-23-31)32-24-16-9-17-25-32/h6-25,27-28,33-34,38-39H,26H2,1-5H3/t27-,28+,33-,34-/m1/s1 |
| InChIKey | YYHMGHWABIZNFT-XWXJLYGMSA-N |
| XLogP | 6.88 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.75 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|