About 1-chloroethyl (2R)-2-trityloxypropanoate
1-chloroethyl (2R)-2-trityloxypropanoate (PubChem CID 155219631) has the molecular formula C24H23ClO3
and a molecular weight of 394.90 g/mol. Its IUPAC name is 1-chloroethyl (2R)-2-trityloxypropanoate.
Molecular Properties
| Compound Name | 1-chloroethyl (2R)-2-trityloxypropanoate |
| PubChem CID | 155219631 |
| Molecular Formula | C24H23ClO3 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 1-chloroethyl (2R)-2-trityloxypropanoate |
| SMILES | CC(Cl)OC(=O)[C@@H](C)OC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H23ClO3/c1-18(23(26)27-19(2)25)28-24(20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-19H,1-2H3/t18-,19?/m1/s1 |
| InChIKey | DZLKDAOLYCEWRU-MRTLOADZSA-N |
| XLogP | 5.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 1-chloroethyl (2R)-2-trityloxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloroethyl (2R)-2-trityloxypropanoate?
The IUPAC name of 1-chloroethyl (2R)-2-trityloxypropanoate (CID 155219631) is 1-chloroethyl (2R)-2-trityloxypropanoate.
What is the SMILES notation for 1-chloroethyl (2R)-2-trityloxypropanoate?
The canonical SMILES for 1-chloroethyl (2R)-2-trityloxypropanoate is CC(Cl)OC(=O)[C@@H](C)OC(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 1-chloroethyl (2R)-2-trityloxypropanoate?
The InChIKey is DZLKDAOLYCEWRU-MRTLOADZSA-N. The full InChI is InChI=1S/C24H23ClO3/c1-18(23(26)27-19(2)25)28-24(20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-19H,1-2H3/t18-,19?/m1/s1.
What are the key properties of 1-chloroethyl (2R)-2-trityloxypropanoate?
1-chloroethyl (2R)-2-trityloxypropanoate has a molecular weight of 394.90 g/mol, XLogP of 5.51, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloroethyl (2R)-2-trityloxypropanoate is sourced from PubChem (CID 155219631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).