C28H32N2O4 — CID 59278497
methyl (2S,3R)-2-(2-aminobutanoylamino)-3-trityloxybutanoate (PubChem CID 59278497) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is methyl (2S,3R)-2-(2-aminobutanoylamino)-3-trityloxybutanoate.
| Compound Name | methyl (2S,3R)-2-(2-aminobutanoylamino)-3-trityloxybutanoate |
|---|---|
| PubChem CID | 59278497 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | methyl (2S,3R)-2-(2-aminobutanoylamino)-3-trityloxybutanoate |
| SMILES | CCC(N)C(=O)N[C@H](C(=O)OC)[C@@H](C)OC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H32N2O4/c1-4-24(29)26(31)30-25(27(32)33-3)20(2)34-28(21-14-8-5-9-15-21,22-16-10-6-11-17-22)23-18-12-7-13-19-23/h5-20,24-25H,4,29H2,1-3H3,(H,30,31)/t20-,24?,25+/m1/s1 |
| InChIKey | GVSFXWCZGHMNOY-AXLDUTFISA-N |
| XLogP | 3.78 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|